Products 1201574-92-6
CAS 1201574-92-6 is the registry number for (3R,4S)-1-Benzyl-4-phenylpyrrolidine-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3R,4S)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid (CAS 1201574-92-6) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid. InChIKey: IMROELKPEBZHGE-SJORKVTESA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | IMROELKPEBZHGE-SJORKVTESA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)