Products 1821739-17-6
CAS 1821739-17-6 appears in our catalog under these names: (3S,4R)-1-Benzyl-4-phenylpyrrolidine-3-carboxylic acid, 97%, 97%, (3S,4R)-1-Benzyl-4-phenylpyrrolidine-3-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid (CAS 1821739-17-6) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid. InChIKey: IMROELKPEBZHGE-DLBZAZTESA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | IMROELKPEBZHGE-DLBZAZTESA-N |
| SMILES | C1[C@H]([C@@H](CN1CC2=CC=CC=C2)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)