Products 1201594-29-7
CAS 1201594-29-7 is the registry number for Methyl 6-(dimethylsulfamayl)oxy-2-naphthoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Methyl 6-(dimethylsulfamoyloxy)naphthalene-2-carboxylate (CAS 1201594-29-7) is a chemical compound with the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. IUPAC name: methyl 6-(dimethylsulfamoyloxy)naphthalene-2-carboxylate. InChIKey: DDXLJBCLYJRZNV-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5S |
|---|---|
| Molecular weight | 309.34 g/mol |
| IUPAC name | methyl 6-(dimethylsulfamoyloxy)naphthalene-2-carboxylate |
| InChIKey | DDXLJBCLYJRZNV-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)OC1=CC2=C(C=C1)C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)