CAS 77853-51-1 is the registry number for 4-Methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxylic acid (CAS 77853-51-1) is a chemical compound with the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. IUPAC name: 4-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: RJAHEEXALIVZOV-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5S |
|---|---|
| Molecular weight | 309.34 g/mol |
| IUPAC name | 4-methyl-2-(3,4,5-trimethoxyphenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | RJAHEEXALIVZOV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C(=C2)OC)OC)OC)C(=O)O |
Computed by PubChem (NCBI)