CAS 924868-99-5 is the registry number for Ethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
Ethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-1,3-thiazole-5-carboxylate (CAS 924868-99-5) is a chemical compound with the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. IUPAC name: ethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-1,3-thiazole-5-carboxylate. InChIKey: ROHANHYAOAFXAH-UHFFFAOYSA-N.
| Molecular formula | C14H15NO5S |
|---|---|
| Molecular weight | 309.34 g/mol |
| IUPAC name | ethyl 2-(3,4-dimethoxyphenyl)-4-hydroxy-1,3-thiazole-5-carboxylate |
| InChIKey | ROHANHYAOAFXAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)C2=CC(=C(C=C2)OC)OC)O |
Computed by PubChem (NCBI)