Products 1201594-37-7
CAS 1201594-37-7 is the registry number for (4-(Trifluoromethyl)phenyl) N,N-dimethylsulfamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
[4-(trifluoromethyl)phenyl] N,N-dimethylsulfamate (CAS 1201594-37-7) is a chemical compound with the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. IUPAC name: [4-(trifluoromethyl)phenyl] N,N-dimethylsulfamate. InChIKey: IIVPSMUDNJKOTM-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO3S |
|---|---|
| Molecular weight | 269.24 g/mol |
| IUPAC name | [4-(trifluoromethyl)phenyl] N,N-dimethylsulfamate |
| InChIKey | IIVPSMUDNJKOTM-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)OC1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)