Products 124551-25-3

CAS 124551-25-3 is the registry number for 1-Methyl-4-vinylpyridinium triflate, thiol scavenging agent. Offered by: Biosynth. Available pack sizes: 0,025g, 0,01g, 0,05g, 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

4-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate (CAS 124551-25-3) is a chemical compound with the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. IUPAC name: 4-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate. InChIKey: HPNLXNXDMUZRCG-UHFFFAOYSA-M.

Identity
Molecular formulaC9H10F3NO3S
Molecular weight269.24 g/mol
IUPAC name4-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate
InChIKeyHPNLXNXDMUZRCG-UHFFFAOYSA-M
SMILESC[N+]1=CC=C(C=C1)C=C.C(F)(F)(F)S(=O)(=O)[O-]

Computed by PubChem (NCBI)