CAS 124551-25-3 is the registry number for 1-Methyl-4-vinylpyridinium triflate, thiol scavenging agent. Offered by: Biosynth. Available pack sizes: 0,025g, 0,01g, 0,05g, 0,25g, 0,1g.
4-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate (CAS 124551-25-3) is a chemical compound with the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. IUPAC name: 4-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate. InChIKey: HPNLXNXDMUZRCG-UHFFFAOYSA-M.
| Molecular formula | C9H10F3NO3S |
|---|---|
| Molecular weight | 269.24 g/mol |
| IUPAC name | 4-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate |
| InChIKey | HPNLXNXDMUZRCG-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=C(C=C1)C=C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)