CAS 339530-78-8 appears in our catalog under these names: 1-Methyl-2-vinylpyridinium triflate, 98%, 98%, 1-Methyl-2-vinylpyridin-1-ium trifluoromethanesulfonate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate (CAS 339530-78-8) is a chemical compound with the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. IUPAC name: 2-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate. InChIKey: VJUSJWUMYXKNPL-UHFFFAOYSA-M.
| Molecular formula | C9H10F3NO3S |
|---|---|
| Molecular weight | 269.24 g/mol |
| IUPAC name | 2-ethenyl-1-methylpyridin-1-ium;trifluoromethanesulfonate |
| InChIKey | VJUSJWUMYXKNPL-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=CC=C1C=C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)