Products 1201658-81-2
CAS 1201658-81-2 appears in our catalog under these names: L-Anserine-d4 (N-b-alanyl-d4), >95% (HPLC), L-Anserine-d4 (N-Beta-alanyl-d4), >95% (HPLC), L-Anserine-d4 (N-beta-alanyl-d4), 98 atom % D, min 98% Chemical Purity, Anserine–d4, Anserine-d4, 99.38%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 0,01g, 0,005g, 500μg, 1 mg.
(2S)-2-[(3-amino-2,2,3,3-tetradeuteriopropanoyl)amino]-3-(3-methylimidazol-4-yl)propanoic acid (CAS 1201658-81-2) is a chemical compound with the molecular formula C10H16N4O3 and a molecular weight of 244.28 g/mol. IUPAC name: (2S)-2-[(3-amino-2,2,3,3-tetradeuteriopropanoyl)amino]-3-(3-methylimidazol-4-yl)propanoic acid. InChIKey: MYYIAHXIVFADCU-XDTSEJTKSA-N.
| Molecular formula | C10H16N4O3 |
|---|---|
| Molecular weight | 244.28 g/mol |
| IUPAC name | (2S)-2-[(3-amino-2,2,3,3-tetradeuteriopropanoyl)amino]-3-(3-methylimidazol-4-yl)propanoic acid |
| InChIKey | MYYIAHXIVFADCU-XDTSEJTKSA-N |
| SMILES | [2H]C([2H])(C(=O)N[C@@H](CC1=CN=CN1C)C(=O)O)C([2H])([2H])N |
Computed by PubChem (NCBI)