CAS 1241524-80-0 is the registry number for 1-(1,3-Dimethyl-4-nitro-1H-pyrazol-5-yl)piperidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,3-dimethyl-4-nitropyrazol-5-yl)piperidin-3-ol (CAS 1241524-80-0) is a chemical compound with the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. IUPAC name: 1-(1,3-dimethyl-4-nitropyrazol-5-yl)piperidin-3-ol. InChIKey: RUUWIYYAXPUJOP-UHFFFAOYSA-N.
| Molecular formula | C10H16N4O3 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-(1,3-dimethyl-4-nitropyrazol-5-yl)piperidin-3-ol |
| InChIKey | RUUWIYYAXPUJOP-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1[N+](=O)[O-])N2CCCC(C2)O)C |
Computed by PubChem (NCBI)