CAS 169283-81-2 is the registry number for Glutamylamidoethyl Imidazole. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-amino-5-[2-(1H-imidazol-5-yl)ethylamino]-5-oxopentanoic acid (CAS 169283-81-2) is a chemical compound with the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. IUPAC name: (4S)-4-amino-5-[2-(1H-imidazol-5-yl)ethylamino]-5-oxopentanoic acid. InChIKey: FLEVPMVPMJVEDN-QMMMGPOBSA-N.
| Molecular formula | C10H16N4O3 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | (4S)-4-amino-5-[2-(1H-imidazol-5-yl)ethylamino]-5-oxopentanoic acid |
| InChIKey | FLEVPMVPMJVEDN-QMMMGPOBSA-N |
| SMILES | C1=C(NC=N1)CCNC(=O)[C@H](CCC(=O)O)N |
Computed by PubChem (NCBI)