CAS 1201684-80-1 appears in our catalog under these names: 2H-1,4-Benzoxazine, 7-bromo-3,4-dihydro-2,2-dimethyl-, 95%, 7-Bromo-2,2-dimethyl-3,4-dihydro-2H-1,4-benzoxazine, 7-Bromo-2,2-dimethyl-3,4-dihydro-2H-benzo[b][1,4]oxazine, 95%, 95%, 7-BROMO-2,2-DIMETHYL-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g, 50mg, 100mg.
7-bromo-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine (CAS 1201684-80-1) is a chemical compound with the molecular formula C10H12BrNO and a molecular weight of 242.11 g/mol. IUPAC name: 7-bromo-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine. InChIKey: LMUSYROBIBYVFQ-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO |
|---|---|
| Molecular weight | 242.11 g/mol |
| IUPAC name | 7-bromo-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine |
| InChIKey | LMUSYROBIBYVFQ-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=C(O1)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)