CAS 1201785-07-0 appears in our catalog under these names: 1,6-Naphthyridine-5,7-diol, 95%, 1,6-Naphthyridine-5,7-diol 95%, 1,6-naphthyridine-5,7-diol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 50mg, 100mg.
5-hydroxy-6H-1,6-naphthyridin-7-one (CAS 1201785-07-0) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 5-hydroxy-6H-1,6-naphthyridin-7-one. InChIKey: PMMUIIWXUKYPAQ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-hydroxy-6H-1,6-naphthyridin-7-one |
| InChIKey | PMMUIIWXUKYPAQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=O)C=C2N=C1)O |
Computed by PubChem (NCBI)