CAS 1201844-73-6 is the registry number for 4-Chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1201844-73-6) is a chemical compound with the molecular formula C15H17BClNO2 and a molecular weight of 289.6 g/mol. IUPAC name: 4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: ANPKKHFSNJKOAM-UHFFFAOYSA-N.
| Molecular formula | C15H17BClNO2 |
|---|---|
| Molecular weight | 289.6 g/mol |
| IUPAC name | 4-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | ANPKKHFSNJKOAM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CN=C3C=C2)Cl |
Computed by PubChem (NCBI)