CAS 1426050-86-3 is the registry number for 3-Chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1426050-86-3) is a chemical compound with the molecular formula C15H17BClNO2 and a molecular weight of 289.6 g/mol. IUPAC name: 3-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: KXQOMSKJQFKMSD-UHFFFAOYSA-N.
| Molecular formula | C15H17BClNO2 |
|---|---|
| Molecular weight | 289.6 g/mol |
| IUPAC name | 3-chloro-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | KXQOMSKJQFKMSD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=NC=C(C=C3C=C2)Cl |
Computed by PubChem (NCBI)