CAS 1355582-91-0 is the registry number for 6-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1355582-91-0) is a chemical compound with the molecular formula C15H17BClNO2 and a molecular weight of 289.6 g/mol. IUPAC name: 6-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: FCFQNUQKKDWIQG-UHFFFAOYSA-N.
| Molecular formula | C15H17BClNO2 |
|---|---|
| Molecular weight | 289.6 g/mol |
| IUPAC name | 6-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | FCFQNUQKKDWIQG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CC(=C3)Cl)N=C2 |
Computed by PubChem (NCBI)