CAS 1202-22-8 appears in our catalog under these names: 4-Chloro-2,6-bis(dimethylamino)pyrimidine, 6-Chloro-N2,N2,N4,N4-tetramethylpyrimidine-2,4-diamine, 95%, 95%, 6-Chloro-N2,N2,N4,N4-tetramethyl-2,4-pyrimidinediamine, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg, 5g.
6-chloro-2-N,2-N,4-N,4-N-tetramethylpyrimidine-2,4-diamine (CAS 1202-22-8) is a chemical compound with the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. IUPAC name: 6-chloro-2-N,2-N,4-N,4-N-tetramethylpyrimidine-2,4-diamine. InChIKey: WOYUZQVWDISJCF-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4 |
|---|---|
| Molecular weight | 200.67 g/mol |
| IUPAC name | 6-chloro-2-N,2-N,4-N,4-N-tetramethylpyrimidine-2,4-diamine |
| InChIKey | WOYUZQVWDISJCF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=NC(=N1)N(C)C)Cl |
Computed by PubChem (NCBI)