CAS 120202-69-9 is the registry number for Methyl (R)-2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate (CAS 120202-69-9) is a chemical compound with the molecular formula C16H16ClNO2S and a molecular weight of 321.8 g/mol. IUPAC name: methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate. InChIKey: GKTWGGQPFAXNFI-OAHLLOKOSA-N.
| Molecular formula | C16H16ClNO2S |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | methyl (2R)-2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate |
| InChIKey | GKTWGGQPFAXNFI-OAHLLOKOSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3 |
Computed by PubChem (NCBI)