Products 917562-26-6
CAS 917562-26-6 is the registry number for 2-Chloro-N-[4,5-dimethyl-3-(4-methyl-benzoyl)-thiophen-2-yl]-acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-[4,5-dimethyl-3-(4-methylbenzoyl)thiophen-2-yl]acetamide (CAS 917562-26-6) is a chemical compound with the molecular formula C16H16ClNO2S and a molecular weight of 321.8 g/mol. IUPAC name: 2-chloro-N-[4,5-dimethyl-3-(4-methylbenzoyl)thiophen-2-yl]acetamide. InChIKey: IKIHLQBYSFTKID-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO2S |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 2-chloro-N-[4,5-dimethyl-3-(4-methylbenzoyl)thiophen-2-yl]acetamide |
| InChIKey | IKIHLQBYSFTKID-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=C(SC(=C2C)C)NC(=O)CCl |
Computed by PubChem (NCBI)