CAS 1396841-05-6 appears in our catalog under these names: Clopidogrel EP Impurity B, Clopidogrel impurity 8, Clopidogrel Impurity 2(Clopidogrel EP Impurity B). Offered by: Chemat Brand, MedChemExpress, Hubei YoungXin. Available pack sizes: on request, Get quote, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl (2S)-2-(2-chlorophenyl)-2-(5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)acetate (CAS 1396841-05-6) is a chemical compound with the molecular formula C16H16ClNO2S and a molecular weight of 321.8 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-(5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)acetate. InChIKey: ZEIGZKQSYIWMTR-HNNXBMFYSA-N.
| Molecular formula | C16H16ClNO2S |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-(5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl)acetate |
| InChIKey | ZEIGZKQSYIWMTR-HNNXBMFYSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)SC=C3 |
Computed by PubChem (NCBI)