Products 1202401-59-9
CAS 1202401-59-9 is the registry number for PC-046. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-methoxyphenyl)-2-[3-(3-methoxyphenyl)-4-pyridinyl]-1,3-oxazole (CAS 1202401-59-9) is a chemical compound with the molecular formula C22H18N2O3 and a molecular weight of 358.4 g/mol. IUPAC name: 5-(4-methoxyphenyl)-2-[3-(3-methoxyphenyl)-4-pyridinyl]-1,3-oxazole. InChIKey: CTNUOHRUVZXVHX-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O3 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-2-[3-(3-methoxyphenyl)-4-pyridinyl]-1,3-oxazole |
| InChIKey | CTNUOHRUVZXVHX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CN=C(O2)C3=C(C=NC=C3)C4=CC(=CC=C4)OC |
Computed by PubChem (NCBI)