Products 87223-13-0
CAS 87223-13-0 is the registry number for 6-(4-Morpholinyl)-2-phenyl-1H-benz(de)isoquinoline-1,3(2H)-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
6-morpholin-4-yl-2-phenylbenzo[de]isoquinoline-1,3-dione (CAS 87223-13-0) is a chemical compound with the molecular formula C22H18N2O3 and a molecular weight of 358.4 g/mol. IUPAC name: 6-morpholin-4-yl-2-phenylbenzo[de]isoquinoline-1,3-dione. InChIKey: GKROIHMLYFBIMT-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O3 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 6-morpholin-4-yl-2-phenylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | GKROIHMLYFBIMT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C3C=CC=C4C3=C(C=C2)C(=O)N(C4=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)