CAS 313660-94-5 appears in our catalog under these names: N-(4-(5-Methoxybenzo[d]oxazol-2-yl)phenyl)-3-methylbenzamide 95%, N-(4-(5-Methoxybenzo[d]oxazol-2-yl)phenyl)-3-methylbenzamide, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]-3-methylbenzamide (CAS 313660-94-5) is a chemical compound with the molecular formula C22H18N2O3 and a molecular weight of 358.4 g/mol. IUPAC name: N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]-3-methylbenzamide. InChIKey: HMZGWAKUSSNIKE-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O3 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | N-[4-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]-3-methylbenzamide |
| InChIKey | HMZGWAKUSSNIKE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)C3=NC4=C(O3)C=CC(=C4)OC |
Computed by PubChem (NCBI)