CAS 120244-82-8 appears in our catalog under these names: Chlorpheniramine N-Oxide, Chlorphenamine Impurity 14. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 10mg, 50mg, 100mg.
3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide (CAS 120244-82-8) is a chemical compound with the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. IUPAC name: 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide. InChIKey: NMEICKDXQPVPKK-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2O |
|---|---|
| Molecular weight | 290.79 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-N,N-dimethyl-3-pyridin-2-ylpropan-1-amine oxide |
| InChIKey | NMEICKDXQPVPKK-UHFFFAOYSA-N |
| SMILES | C[N+](C)(CCC(C1=CC=C(C=C1)Cl)C2=CC=CC=N2)[O-] |
Computed by PubChem (NCBI)