Products 391901-43-2
CAS 391901-43-2 is the registry number for Mirabegron Impurity 95. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2-[2-(4-aminophenyl)ethylamino]-1-(3-chlorophenyl)ethanol (CAS 391901-43-2) is a chemical compound with the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. IUPAC name: (1R)-2-[2-(4-aminophenyl)ethylamino]-1-(3-chlorophenyl)ethanol. InChIKey: WDWIHURZYAZSBL-INIZCTEOSA-N.
| Molecular formula | C16H19ClN2O |
|---|---|
| Molecular weight | 290.79 g/mol |
| IUPAC name | (1R)-2-[2-(4-aminophenyl)ethylamino]-1-(3-chlorophenyl)ethanol |
| InChIKey | WDWIHURZYAZSBL-INIZCTEOSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CNCCC2=CC=C(C=C2)N)O |
Computed by PubChem (NCBI)