Products 899821-23-9
CAS 899821-23-9 appears in our catalog under these names: Acp-105, 95%, ACP-105, >95% (HPLC), ACP-105/ 99.53% (existing batch purity), ACP–105, ACP-105, 99%, 99%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 100mg, 10mg, 2,5mg, 5mg, 2mg, 25mg, 50mg, 200mg.
2-chloro-4-[(1R,5S)-3-hydroxy-3-methyl-8-azabicyclo[3.2.1]octan-8-yl]-3-methylbenzonitrile (CAS 899821-23-9) is a chemical compound with the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. IUPAC name: 2-chloro-4-[(1R,5S)-3-hydroxy-3-methyl-8-azabicyclo[3.2.1]octan-8-yl]-3-methylbenzonitrile. InChIKey: OUEODVPKPRQETQ-OCZCAGDBSA-N.
| Molecular formula | C16H19ClN2O |
|---|---|
| Molecular weight | 290.79 g/mol |
| IUPAC name | 2-chloro-4-[(1R,5S)-3-hydroxy-3-methyl-8-azabicyclo[3.2.1]octan-8-yl]-3-methylbenzonitrile |
| InChIKey | OUEODVPKPRQETQ-OCZCAGDBSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)C#N)N2[C@@H]3CC[C@H]2CC(C3)(C)O |
Computed by PubChem (NCBI)
Synonyms:
orb1308694, orb1940737