CAS 120266-80-0 appears in our catalog under these names: 5-Aminoindolin-2-one hydrochloride, 95%, 5–Aminoindolin–2–one hydrochloride, 5-AMINOOXINDOLE HYDROCHLORIDE. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 500MG.
5-amino-1,3-dihydroindol-2-one;hydrochloride (CAS 120266-80-0) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 5-amino-1,3-dihydroindol-2-one;hydrochloride. InChIKey: XOFGLOAMJJWHMZ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 5-amino-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | XOFGLOAMJJWHMZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)N)NC1=O.Cl |
Computed by PubChem (NCBI)