Products 1202867-00-2
CAS 1202867-00-2 appears in our catalog under these names: Dynasore hydrate, 95%, DYNASORE HYDRATE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 100mg, 25MG, 5MG.
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide;hydrate (CAS 1202867-00-2) is a chemical compound with the molecular formula C18H16N2O5 and a molecular weight of 340.3 g/mol. IUPAC name: N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide;hydrate. InChIKey: FKWZHQSDBMSHTN-ZIOFAICLSA-N.
| Molecular formula | C18H16N2O5 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-3-hydroxynaphthalene-2-carboxamide;hydrate |
| InChIKey | FKWZHQSDBMSHTN-ZIOFAICLSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)N/N=C/C3=CC(=C(C=C3)O)O)O.O |
Computed by PubChem (NCBI)