CAS 319491-16-2 is the registry number for 6-(4-Morpholinyl)-1,3-dioxo-1H-benz(de)isoquinoline-2(3H)-acetic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)acetic acid (CAS 319491-16-2) is a chemical compound with the molecular formula C18H16N2O5 and a molecular weight of 340.3 g/mol. IUPAC name: 2-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)acetic acid. InChIKey: RCHYKCHYASAGME-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O5 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 2-(6-morpholin-4-yl-1,3-dioxobenzo[de]isoquinolin-2-yl)acetic acid |
| InChIKey | RCHYKCHYASAGME-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C3C=CC=C4C3=C(C=C2)C(=O)N(C4=O)CC(=O)O |
Computed by PubChem (NCBI)