CAS 258831-77-5 is the registry number for 5-Carboxy SU 5402. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
4-(2-carboxyethyl)-3-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylic acid (CAS 258831-77-5) is a chemical compound with the molecular formula C18H16N2O5 and a molecular weight of 340.3 g/mol. IUPAC name: 4-(2-carboxyethyl)-3-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylic acid. InChIKey: ALNIKEXQACPSPW-WQLSENKSSA-N.
| Molecular formula | C18H16N2O5 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 4-(2-carboxyethyl)-3-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrole-2-carboxylic acid |
| InChIKey | ALNIKEXQACPSPW-WQLSENKSSA-N |
| SMILES | CC1=C(NC(=C1CCC(=O)O)/C=C\2/C3=CC=CC=C3NC2=O)C(=O)O |
Computed by PubChem (NCBI)