CAS 1203-48-1 appears in our catalog under these names: 8-Chloro-2,3-dimethylquinolin-4-ol, 97%, 8-Chloro-2,3-dimethyl-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 50mg, 0,5g.
8-chloro-2,3-dimethyl-1H-quinolin-4-one (CAS 1203-48-1) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 8-chloro-2,3-dimethyl-1H-quinolin-4-one. InChIKey: WTXKTFUXPMJFQQ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 8-chloro-2,3-dimethyl-1H-quinolin-4-one |
| InChIKey | WTXKTFUXPMJFQQ-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C(C1=O)C=CC=C2Cl)C |
Computed by PubChem (NCBI)