CAS 120330-92-9 is the registry number for N-((+)-Jasmonoyl)-(L)-isoleucine, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(2S,3S)-3-methyl-2-[[2-[(1S,2S)-3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid (CAS 120330-92-9) is a chemical compound with the molecular formula C18H29NO4 and a molecular weight of 323.4 g/mol. IUPAC name: (2S,3S)-3-methyl-2-[[2-[(1S,2S)-3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid. InChIKey: IBZYPBGPOGJMBF-SEHUJUFYSA-N.
| Molecular formula | C18H29NO4 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-[[2-[(1S,2S)-3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid |
| InChIKey | IBZYPBGPOGJMBF-SEHUJUFYSA-N |
| SMILES | CC/C=C/C[C@H]1[C@@H](CCC1=O)CC(=O)N[C@@H]([C@@H](C)CC)C(=O)O |
Computed by PubChem (NCBI)