Products 776330-69-9
CAS 776330-69-9 is the registry number for Boc-3-amino-3-(adamantan-1-yl)-propionic acid. Offered by: Iris Biotech. Available pack sizes: on request.
3-(1-adamantyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 776330-69-9) is a chemical compound with the molecular formula C18H29NO4 and a molecular weight of 323.4 g/mol. IUPAC name: 3-(1-adamantyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: WUZJLHKXDSEKRU-UHFFFAOYSA-N.
| Molecular formula | C18H29NO4 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 3-(1-adamantyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | WUZJLHKXDSEKRU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)