Products 2230807-57-3
CAS 2230807-57-3 is the registry number for 3-{((tert-Butoxy)carbonyl)amino}-5,7-dimethyladamantane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,5-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-1-carboxylic acid (CAS 2230807-57-3) is a chemical compound with the molecular formula C18H29NO4 and a molecular weight of 323.4 g/mol. IUPAC name: 3,5-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-1-carboxylic acid. InChIKey: XCYDUFDZEYUXTG-UHFFFAOYSA-N.
| Molecular formula | C18H29NO4 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 3,5-dimethyl-7-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-1-carboxylic acid |
| InChIKey | XCYDUFDZEYUXTG-UHFFFAOYSA-N |
| SMILES | CC12CC3(CC(C1)(CC(C2)(C3)NC(=O)OC(C)(C)C)C(=O)O)C |
Computed by PubChem (NCBI)