CAS 1203427-84-2 is the registry number for 2-Chloro-5-{(2-(pyrrolidin-1-yl)ethyl)sulfamoyl}benzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-5-(2-pyrrolidin-1-ylethylsulfamoyl)benzoic acid (CAS 1203427-84-2) is a chemical compound with the molecular formula C13H17ClN2O4S and a molecular weight of 332.80 g/mol. IUPAC name: 2-chloro-5-(2-pyrrolidin-1-ylethylsulfamoyl)benzoic acid. InChIKey: ZKTUOTYWIHZZJG-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O4S |
|---|---|
| Molecular weight | 332.80 g/mol |
| IUPAC name | 2-chloro-5-(2-pyrrolidin-1-ylethylsulfamoyl)benzoic acid |
| InChIKey | ZKTUOTYWIHZZJG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCNS(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)