CAS 263897-19-4 appears in our catalog under these names: 2-Chloro-5-(4-ethyl-piperazine-1-sulfonyl)-benzoic acid, 95%, 2-Chloro-5-((4-ethylpiperazin-1-yl)sulfonyl)benzoic acid, 98%, 98%, 2-Chloro-5-[(4-ethylpiperazin-1-yl)sulfonyl]benzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 500mg.
2-chloro-5-(4-ethylpiperazin-1-yl)sulfonylbenzoic acid (CAS 263897-19-4) is a chemical compound with the molecular formula C13H17ClN2O4S and a molecular weight of 332.80 g/mol. IUPAC name: 2-chloro-5-(4-ethylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: FJDYPIZFPSVWCA-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O4S |
|---|---|
| Molecular weight | 332.80 g/mol |
| IUPAC name | 2-chloro-5-(4-ethylpiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | FJDYPIZFPSVWCA-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)