CAS 749920-16-9 is the registry number for 1-(4-Chloro-3-nitrobenzenesulfonyl)-3,5-dimethylpiperidine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-chloro-3-nitrophenyl)sulfonyl-3,5-dimethylpiperidine (CAS 749920-16-9) is a chemical compound with the molecular formula C13H17ClN2O4S and a molecular weight of 332.80 g/mol. IUPAC name: 1-(4-chloro-3-nitrophenyl)sulfonyl-3,5-dimethylpiperidine. InChIKey: YIKHDNAYAGNMPZ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O4S |
|---|---|
| Molecular weight | 332.80 g/mol |
| IUPAC name | 1-(4-chloro-3-nitrophenyl)sulfonyl-3,5-dimethylpiperidine |
| InChIKey | YIKHDNAYAGNMPZ-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)S(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-])C |
Computed by PubChem (NCBI)