Products 1203428-11-8
CAS 1203428-11-8 is the registry number for 4-({4-(2-(Pyrrolidin-1-yl)ethyl)piperazin-1-yl}sulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]sulfonylbenzoic acid (CAS 1203428-11-8) is a chemical compound with the molecular formula C17H25N3O4S and a molecular weight of 367.5 g/mol. IUPAC name: 4-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]sulfonylbenzoic acid. InChIKey: LWOQTBKEPZFWLT-UHFFFAOYSA-N.
| Molecular formula | C17H25N3O4S |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | 4-[4-(2-pyrrolidin-1-ylethyl)piperazin-1-yl]sulfonylbenzoic acid |
| InChIKey | LWOQTBKEPZFWLT-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCN2CCN(CC2)S(=O)(=O)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)