Products 66183-70-8
CAS 66183-70-8 appears in our catalog under these names: Cipropride S enantiomer/ 99.82% (existing batch purity), Cipropride S enantiomer, Cipropride S enantiomer, Cipropride (S enantiomer). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 20mg.
N-[[(2S)-1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]-2-methoxy-5-sulfamoylbenzamide (CAS 66183-70-8) is a chemical compound with the molecular formula C17H25N3O4S and a molecular weight of 367.5 g/mol. IUPAC name: N-[[(2S)-1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]-2-methoxy-5-sulfamoylbenzamide. InChIKey: BTYDXWCTJDAEHA-ZDUSSCGKSA-N.
| Molecular formula | C17H25N3O4S |
|---|---|
| Molecular weight | 367.5 g/mol |
| IUPAC name | N-[[(2S)-1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]-2-methoxy-5-sulfamoylbenzamide |
| InChIKey | BTYDXWCTJDAEHA-ZDUSSCGKSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N)C(=O)NC[C@@H]2CCCN2CC3CC3 |
Computed by PubChem (NCBI)