CAS 1203499-50-6 is the registry number for 2-Chloro-n-methoxy-n,5-dimethylnicotinamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-N-methoxy-N,5-dimethylpyridine-3-carboxamide (CAS 1203499-50-6) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 2-chloro-N-methoxy-N,5-dimethylpyridine-3-carboxamide. InChIKey: HYCMGOXJFZMPHD-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 2-chloro-N-methoxy-N,5-dimethylpyridine-3-carboxamide |
| InChIKey | HYCMGOXJFZMPHD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)Cl)C(=O)N(C)OC |
Computed by PubChem (NCBI)