CAS 120362-69-8 is the registry number for 8-Bromobenzo[a]aceanthrylene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
13-bromopentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene (CAS 120362-69-8) is a chemical compound with the molecular formula C20H11Br and a molecular weight of 331.2 g/mol. IUPAC name: 13-bromopentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene. InChIKey: PLHAWPYGTPLGAI-UHFFFAOYSA-N.
| Molecular formula | C20H11Br |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | 13-bromopentacyclo[10.7.1.02,7.08,20.014,19]icosa-1(20),2,4,6,8,10,12,14,16,18-decaene |
| InChIKey | PLHAWPYGTPLGAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC4=C(C5=CC=CC=C5C2=C43)Br |
Computed by PubChem (NCBI)