CAS 21248-00-0 appears in our catalog under these names: 6-Bromobenzo{a}pyrene, >95% (HPLC), 6-Bromobenzo(A)pyrene. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 50mg, 25mg.
6-bromobenzo[a]pyrene (CAS 21248-00-0) is a chemical compound with the molecular formula C20H11Br and a molecular weight of 331.2 g/mol. IUPAC name: 6-bromobenzo[a]pyrene. InChIKey: MJSYSGSEEADMTK-UHFFFAOYSA-N.
| Molecular formula | C20H11Br |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | 6-bromobenzo[a]pyrene |
| InChIKey | MJSYSGSEEADMTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=C2Br)C=CC5=CC=CC(=C54)C=C3 |
Computed by PubChem (NCBI)