CAS 23683-68-3 appears in our catalog under these names: 3–Bromoperylene, 3-Bromoperylene, 3-Bromoperylene 90%, 3-Bromoperylene, 90%, 3-Bromoperylene, 95-<97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Hoffman Fine Chemicals. Available pack sizes: 1g, 250mg, 5g, 0,05g, 0,1g, 0,25g, 0,5g, 100mg.
3-bromoperylene (CAS 23683-68-3) is a chemical compound with the molecular formula C20H11Br and a molecular weight of 331.2 g/mol. IUPAC name: 3-bromoperylene. InChIKey: GPBMCEWKAPSTOU-UHFFFAOYSA-N.
| Molecular formula | C20H11Br |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | 3-bromoperylene |
| InChIKey | GPBMCEWKAPSTOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C4=C5C(=CC=C4)C(=CC=C5C3=CC=C2)Br |
Computed by PubChem (NCBI)