Products 1203662-45-6
CAS 1203662-45-6 is the registry number for Tert-butyl 2,3-difluoro-4-methylbenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2,3-difluoro-4-methylbenzoate (CAS 1203662-45-6) is a chemical compound with the molecular formula C12H14F2O2 and a molecular weight of 228.23 g/mol. IUPAC name: tert-butyl 2,3-difluoro-4-methylbenzoate. InChIKey: RAFRCYFBQXEZFH-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O2 |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | tert-butyl 2,3-difluoro-4-methylbenzoate |
| InChIKey | RAFRCYFBQXEZFH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC(C)(C)C)F)F |
Computed by PubChem (NCBI)