CAS 1248927-78-7 appears in our catalog under these names: Ethyl 2-(3,5-dimethylphenyl)-2,2-difluoroacetate, 98%, ethyl 2–(3,5–dimethylphenyl)–2,2–difluoroacetate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
Ethyl 2-(3,5-dimethylphenyl)-2,2-difluoroacetate (CAS 1248927-78-7) is a chemical compound with the molecular formula C12H14F2O2 and a molecular weight of 228.23 g/mol. IUPAC name: ethyl 2-(3,5-dimethylphenyl)-2,2-difluoroacetate. InChIKey: ZBVWSEHPRHFLOP-UHFFFAOYSA-N.
| Molecular formula | C12H14F2O2 |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | ethyl 2-(3,5-dimethylphenyl)-2,2-difluoroacetate |
| InChIKey | ZBVWSEHPRHFLOP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=CC(=C1)C)C)(F)F |
Computed by PubChem (NCBI)