Products 2852766-18-6
CAS 2852766-18-6 is the registry number for (R)-(1-((Benzyloxy)methyl)-2,2-difluorocyclopropyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R)-2,2-difluoro-1-(phenylmethoxymethyl)cyclopropyl]methanol (CAS 2852766-18-6) is a chemical compound with the molecular formula C12H14F2O2 and a molecular weight of 228.23 g/mol. IUPAC name: [(1R)-2,2-difluoro-1-(phenylmethoxymethyl)cyclopropyl]methanol. InChIKey: PDDRHFIJIAPCHX-LLVKDONJSA-N.
| Molecular formula | C12H14F2O2 |
|---|---|
| Molecular weight | 228.23 g/mol |
| IUPAC name | [(1R)-2,2-difluoro-1-(phenylmethoxymethyl)cyclopropyl]methanol |
| InChIKey | PDDRHFIJIAPCHX-LLVKDONJSA-N |
| SMILES | C1[C@@](C1(F)F)(CO)COCC2=CC=CC=C2 |
Computed by PubChem (NCBI)