CAS 1203683-85-5 appears in our catalog under these names: 4-(Pyrrolidin-2-yl)benzonitrile (hydrochloride), 98%, 4-(PYRROLIDIN-2-YL)BENZONITRILE HYDROCHLORIDE, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 50mg, 100mg, 250mg.
4-pyrrolidin-2-ylbenzonitrile;hydrochloride (CAS 1203683-85-5) is a chemical compound with the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. IUPAC name: 4-pyrrolidin-2-ylbenzonitrile;hydrochloride. InChIKey: BYDYEWOFVBQCFS-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2 |
|---|---|
| Molecular weight | 208.69 g/mol |
| IUPAC name | 4-pyrrolidin-2-ylbenzonitrile;hydrochloride |
| InChIKey | BYDYEWOFVBQCFS-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=C(C=C2)C#N.Cl |
Computed by PubChem (NCBI)