CAS 1203685-18-0 appears in our catalog under these names: 3-((4-(Trifluoromethyl)phenyl)methyl)azetidine Hydrochloride, >95% (HPLC), 3–(4–(Trifluoromethyl)benzyl)azetidine hydrochloride, 3-{(4-(Trifluoromethyl)phenyl)methyl}azetidine hydrochloride, 3-(4-(Trifluoromethyl)benzyl)azetidine hydrochloride, 97%, 97%, 3-(4-(Trifluoromethyl)benzyl)azetidine hydrochloride, 97%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 500mg.
3-[[4-(trifluoromethyl)phenyl]methyl]azetidine;hydrochloride (CAS 1203685-18-0) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: 3-[[4-(trifluoromethyl)phenyl]methyl]azetidine;hydrochloride. InChIKey: MBDLPYRHZMBWMZ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 3-[[4-(trifluoromethyl)phenyl]methyl]azetidine;hydrochloride |
| InChIKey | MBDLPYRHZMBWMZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)