CAS 1204-21-3 appears in our catalog under these names: 2-Bromo-2',5'-dimethoxyacetophenone 99%, 2-Bromo-1-(2,5-dimethoxyphenyl)ethanone, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 100g.
2-bromo-1-(2,5-dimethoxyphenyl)ethanone (CAS 1204-21-3) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 2-bromo-1-(2,5-dimethoxyphenyl)ethanone. InChIKey: RGQNFYVSEWDUEI-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-bromo-1-(2,5-dimethoxyphenyl)ethanone |
| InChIKey | RGQNFYVSEWDUEI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)CBr |
Computed by PubChem (NCBI)