CAS 1204295-81-7 is the registry number for 4-(2,2,2-Trifluoroethyl)-1,1'-biphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
1-phenyl-4-(2,2,2-trifluoroethyl)benzene (CAS 1204295-81-7) is a chemical compound with the molecular formula C14H11F3 and a molecular weight of 236.23 g/mol. IUPAC name: 1-phenyl-4-(2,2,2-trifluoroethyl)benzene. InChIKey: PXSKQADLXIFXQR-UHFFFAOYSA-N.
| Molecular formula | C14H11F3 |
|---|---|
| Molecular weight | 236.23 g/mol |
| IUPAC name | 1-phenyl-4-(2,2,2-trifluoroethyl)benzene |
| InChIKey | PXSKQADLXIFXQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(F)(F)F |
Computed by PubChem (NCBI)